EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26N6O3 |
| Net Charge | 0 |
| Average Mass | 482.544 |
| Monoisotopic Mass | 482.20664 |
| SMILES | COc1cc(Nc2ccc3ncc(N4CCOCC4)nc3c2C#N)ccc1OCc1ccc(C)nc1 |
| InChI | InChI=1S/C27H26N6O3/c1-18-3-4-19(15-29-18)17-36-24-8-5-20(13-25(24)34-2)31-22-6-7-23-27(21(22)14-28)32-26(16-30-23)33-9-11-35-12-10-33/h3-8,13,15-16,31H,9-12,17H2,1-2H3 |
| InChIKey | UGKFKFGVNJJPOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enrupatinib (CHEBI:759869) has role antineoplastic agent (CHEBI:35610) |
| enrupatinib (CHEBI:759869) is a quinoxaline derivative (CHEBI:38771) |
| INN | Source |
|---|---|
| enrupatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ei-1071 | ChEMBL |
| EI1071 | ChEMBL |