EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O3 |
| Net Charge | 0 |
| Average Mass | 355.398 |
| Monoisotopic Mass | 355.16444 |
| SMILES | CCOC(=O)c1cnc2nccc2c1N[C@@H]1CCCN(C(=O)CC#N)C1 |
| InChI | InChI=1S/C18H21N5O3/c1-2-26-18(25)14-10-21-17-13(6-8-20-17)16(14)22-12-4-3-9-23(11-12)15(24)5-7-19/h6,8,10,12H,2-5,9,11H2,1H3,(H2,20,21,22)/t12-/m1/s1 |
| InChIKey | QQOPOYMFJLUSBI-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lepzacitinib (CHEBI:759867) has role dermatologic drug (CHEBI:50177) |
| lepzacitinib (CHEBI:759867) is a pyrrolopyridine (CHEBI:46771) |
| INN | Source |
|---|---|
| lepzacitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ATI-1777 | ChEMBL |
| ATI1777 | ChEMBL |