EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N4O4S2 |
| Net Charge | 0 |
| Average Mass | 514.673 |
| Monoisotopic Mass | 514.17085 |
| SMILES | C=CC(=O)N1CCCN(C(=O)c2cc(Sc3cnc(NC(=O)C4CC4)s3)c(C)cc2OC)C[C@H]1C |
| InChI | InChI=1S/C25H30N4O4S2/c1-5-21(30)29-10-6-9-28(14-16(29)3)24(32)18-12-20(15(2)11-19(18)33-4)34-22-13-26-25(35-22)27-23(31)17-7-8-17/h5,11-13,16-17H,1,6-10,14H2,2-4H3,(H,26,27,31)/t16-/m1/s1 |
| InChIKey | KNCWSXRTKLTULH-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soquelitinib (CHEBI:759864) has role antineoplastic agent (CHEBI:35610) |
| soquelitinib (CHEBI:759864) has role dermatologic drug (CHEBI:50177) |
| soquelitinib (CHEBI:759864) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| soquelitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP-000596 | ChEMBL |
| CP-596 | ChEMBL |
| CPI-000818 | ChEMBL |
| CPI-596 | ChEMBL |
| CPI596 | ChEMBL |
| CPI-818 | ChEMBL |