EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClFN2O2 |
| Net Charge | 0 |
| Average Mass | 362.832 |
| Monoisotopic Mass | 362.11973 |
| SMILES | CN1CC[C@@H](COC(=O)Nc2ccccc2-c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H20ClFN2O2/c1-23-9-8-13(11-23)12-25-19(24)22-18-5-3-2-4-15(18)14-6-7-17(21)16(20)10-14/h2-7,10,13H,8-9,11-12H2,1H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | SYBGVVSJNMTWCI-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| velufenacin (CHEBI:759862) has role renoprotective agent (CHEBI:231911) |
| velufenacin (CHEBI:759862) is a biphenyls (CHEBI:22888) |
| velufenacin (CHEBI:759862) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| Da-8010 | ChEMBL |
| Velufenacin | ChEMBL |