EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H17F3N4O4 |
| Net Charge | 0 |
| Average Mass | 482.418 |
| Monoisotopic Mass | 482.12019 |
| SMILES | O=C1CCc2c(Oc3ccc4c(c3)[C@H]3[C@H](NC(=O)Nc5cc(F)c(F)cc5F)[C@H]3O4)ccnc2N1 |
| InChI | InChI=1S/C24H17F3N4O4/c25-13-8-15(27)16(9-14(13)26)29-24(33)31-21-20-12-7-10(1-3-17(12)35-22(20)21)34-18-5-6-28-23-11(18)2-4-19(32)30-23/h1,3,5-9,20-22H,2,4H2,(H,28,30,32)(H2,29,31,33)/t20-,21-,22-/m0/s1 |
| InChIKey | USMWOBMHNWNPAP-FKBYEOEOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brimarafenib (CHEBI:759861) has role antineoplastic agent (CHEBI:35610) |
| brimarafenib (CHEBI:759861) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| brimarafenib | WHO MedNet |