EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26Cl2N4O2 |
| Net Charge | 0 |
| Average Mass | 437.371 |
| Monoisotopic Mass | 436.14328 |
| SMILES | Cc1c(N2CCC3(CC2)CO[C@@H](C)[C@H]3N)nc(C)n(-c2cccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C21H26Cl2N4O2/c1-12-19(26-9-7-21(8-10-26)11-29-13(2)18(21)24)25-14(3)27(20(12)28)16-6-4-5-15(22)17(16)23/h4-6,13,18H,7-11,24H2,1-3H3/t13-,18+/m0/s1 |
| InChIKey | ABKATOFAZUIEJX-SCLBCKFNSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bbp-398 (CHEBI:759860) has role antineoplastic agent (CHEBI:35610) |
| bbp-398 (CHEBI:759860) is a azaspiro compound (CHEBI:35624) |
| Synonyms | Source |
|---|---|
| Bbp-398 | ChEMBL |
| Bms-986466 | ChEMBL |
| IACS-15509 | ChEMBL |