EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H57F2N7O7S |
| Net Charge | 0 |
| Average Mass | 902.078 |
| Monoisotopic Mass | 901.40082 |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(NC[C@H]5CC[C@](C)(O)CC5)c([N+](=O)[O-])c4)c(Oc4cnc5nccc5c4)c3)CC2)=C(C23CC(C(F)F)(C2)C3)C1 |
| InChI | InChI=1S/C47H57F2N7O7S/c1-44(2)12-10-32(37(23-44)46-27-47(28-46,29-46)43(48)49)26-54-16-18-55(19-17-54)33-4-6-36(40(21-33)63-34-20-31-11-15-50-41(31)52-25-34)42(57)53-64(61,62)35-5-7-38(39(22-35)56(59)60)51-24-30-8-13-45(3,58)14-9-30/h4-7,11,15,20-22,25,30,43,51,58H,8-10,12-14,16-19,23-24,26-29H2,1-3H3,(H,50,52)(H,53,57)/t30-,45-,46?,47? |
| InChIKey | DREKSGOBSPWACW-MNMGTKACSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asaretoclax (CHEBI:759859) has role antineoplastic agent (CHEBI:35610) |
| asaretoclax (CHEBI:759859) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| asaretoclax | WHO MedNet |