EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30F3N5O5 |
| Net Charge | 0 |
| Average Mass | 489.495 |
| Monoisotopic Mass | 489.21990 |
| SMILES | COC(=O)N[C@H](C(=O)N1C[C@H](C(F)(F)F)C[C@H]1C(=O)N[C@H](C#N)C[C@@H]1CCNC1=O)C(C)(C)C |
| InChI | InChI=1S/C21H30F3N5O5/c1-20(2,3)15(28-19(33)34-4)18(32)29-10-12(21(22,23)24)8-14(29)17(31)27-13(9-25)7-11-5-6-26-16(11)30/h11-15H,5-8,10H2,1-4H3,(H,26,30)(H,27,31)(H,28,33)/t11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | WGNWEPPRWQKSKI-AIEDFZFUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibuzatrelvir (CHEBI:759855) has role anticoronaviral agent (CHEBI:149553) |
| ibuzatrelvir (CHEBI:759855) has role antiviral agent (CHEBI:22587) |
| ibuzatrelvir (CHEBI:759855) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Ibuzatrelvir | ChEMBL |
| PF-07817883 | ChEMBL |
| Citations |
|---|