EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N4O4S |
| Net Charge | 0 |
| Average Mass | 430.530 |
| Monoisotopic Mass | 430.16748 |
| SMILES | COc1ncc(C2=CCOCC2)c2sc(NC(=O)N3CC[C@@]4(CCCOC4)C3)nc12 |
| InChI | InChI=1S/C21H26N4O4S/c1-27-18-16-17(15(11-22-18)14-3-9-28-10-4-14)30-19(23-16)24-20(26)25-7-6-21(12-25)5-2-8-29-13-21/h3,11H,2,4-10,12-13H2,1H3,(H,23,24,26)/t21-/m0/s1 |
| InChIKey | CSSAKLQGJYJMNW-NRFANRHFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muvadenant (CHEBI:759853) has role antineoplastic agent (CHEBI:35610) |
| muvadenant (CHEBI:759853) is a pyrrolidinecarboxamide (CHEBI:46770) |
| INN | Source |
|---|---|
| muvadenant | WHO MedNet |
| Citations |
|---|