EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22ClN7S |
| Net Charge | 0 |
| Average Mass | 439.976 |
| Monoisotopic Mass | 439.13459 |
| SMILES | Nc1nccc(Sc2cnc(N3CCC4(CC3)Cc3ccccc3[C@H]4N)nn2)c1Cl |
| InChI | InChI=1S/C21H22ClN7S/c22-17-15(5-8-25-19(17)24)30-16-12-26-20(28-27-16)29-9-6-21(7-10-29)11-13-3-1-2-4-14(13)18(21)23/h1-5,8,12,18H,6-7,9-11,23H2,(H2,24,25)/t18-/m1/s1 |
| InChIKey | HZCJDRDHKWNUGN-GOSISDBHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-07284892 (CHEBI:759848) has role antineoplastic agent (CHEBI:35610) |
| pf-07284892 (CHEBI:759848) is a aryl sulfide (CHEBI:35683) |
| Synonyms | Source |
|---|---|
| ARRY-558 | ChEMBL |
| Pf-07284892 | ChEMBL |
| Citations |
|---|