EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | As2O3 |
| Net Charge | 0 |
| Average Mass | 197.841 |
| Monoisotopic Mass | 197.82794 |
| SMILES | O=[As][As+](=O)[O-] |
| InChI | InChI=1S/As2O3/c3-1-2(4)5 |
| InChIKey | MOQADKPFYVWPSE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsenic trioxide (CHEBI:759843) has role antifibrotic agent (CHEBI:233423) |
| arsenic trioxide (CHEBI:759843) has role antineoplastic agent (CHEBI:35610) |
| arsenic trioxide (CHEBI:759843) is a organic salt (CHEBI:24868) |
| Synonyms | Source |
|---|---|
| Arseneous anhydride | ChEMBL |
| Arseneous oxide | ChEMBL |
| Arsenic oxide (as4o6) | ChEMBL |
| Arsenicum album | ChEMBL |
| NSC-759274 | ChEMBL |
| NSC-92859 | ChEMBL |
| Brand Names | Source |
|---|---|
| Arsenic trioxide accord | ChEMBL |
| Arsenic trioxide medac | ChEMBL |
| Arsenic trioxide mylan | ChEMBL |
| Citations |
|---|