EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20F6N2O3 |
| Net Charge | 0 |
| Average Mass | 414.346 |
| Monoisotopic Mass | 414.13781 |
| SMILES | O=C(NCC1CCCCN1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H20F6N2O3/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26) |
| InChIKey | DJBNUMBKLMJRSA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flecainide (CHEBI:75984) has role anti-arrhythmia drug (CHEBI:38070) |
| flecainide (CHEBI:75984) is a aromatic ether (CHEBI:35618) |
| flecainide (CHEBI:75984) is a monocarboxylic acid amide (CHEBI:29347) |
| flecainide (CHEBI:75984) is a organofluorine compound (CHEBI:37143) |
| flecainide (CHEBI:75984) is a piperidines (CHEBI:26151) |
| flecainide (CHEBI:75984) is conjugate base of flecainide(1+) (CHEBI:76033) |
| Incoming Relation(s) |
| flecainide(1+) (CHEBI:76033) is conjugate acid of flecainide (CHEBI:75984) |
| IUPAC Name |
|---|
| N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| INNs | Source |
|---|---|
| flecainida | DrugBank |
| flecainide | KEGG DRUG |
| flécaïnide | WHO MedNet |
| flecainidum | DrugBank |
| Synonyms | Source |
|---|---|
| CCRIS 313 | ChemIDplus |
| Flecaine | ChemIDplus |
| (±)-flecainide | ChemIDplus |
| N-(2-Piperidinylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1176 | DrugCentral |
| C07001 | KEGG COMPOUND |
| D07962 | KEGG DRUG |
| DB01195 | DrugBank |
| Flecainide | Wikipedia |
| HMDB0015326 | HMDB |
| LSM-1297 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:500093 | Reaxys |
| CAS:54143-55-4 | ChemIDplus |
| CAS:54143-55-4 | KEGG COMPOUND |
| Citations |
|---|