EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N4O2S |
| Net Charge | 0 |
| Average Mass | 358.467 |
| Monoisotopic Mass | 358.14635 |
| SMILES | COC[C@@H](CC(C)C)NC1=N/C(=C\c2ccc3ncsc3c2)C(=O)N1 |
| InChI | InChI=1S/C18H22N4O2S/c1-11(2)6-13(9-24-3)20-18-21-15(17(23)22-18)7-12-4-5-14-16(8-12)25-10-19-14/h4-5,7-8,10-11,13H,6,9H2,1-3H3,(H2,20,21,22,23)/b15-7-/t13-/m1/s1 |
| InChIKey | CHQYAWLKOUOTQO-QVYJARAXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(6-benzothiazolylmethylene)-3,5-dihydro-2-(((1s)-1-(methoxymethyl)-3-methylbutyl)amino)-4h-imidazol-4-one, (5z)- (CHEBI:759839) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| 5-(6-benzothiazolylmethylene)-3,5-dihydro-2-(((1s)-1-(methoxymethyl)-3-methylbutyl)amino)-4h-imidazol-4-one, (5z)- | ChEMBL |
| Leucettinib-21 | ChEMBL |
| Citations |
|---|