EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29BrN4O8S2 |
| Net Charge | 0 |
| Average Mass | 585.499 |
| Monoisotopic Mass | 584.06102 |
| SMILES | CCN1CCN(C(=O)c2cc(N(CCBr)CCOS(C)(=O)=O)c(S(C)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H29BrN4O8S2/c1-4-21-7-9-23(10-8-21)19(25)15-13-17(18(33(2,28)29)14-16(15)24(26)27)22(6-5-20)11-12-32-34(3,30)31/h13-14H,4-12H2,1-3H3 |
| InChIKey | SKBYSCFKFJRHSZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cp-506 (CHEBI:759835) has role antineoplastic agent (CHEBI:35610) |
| cp-506 (CHEBI:759835) is a benzamides (CHEBI:22702) |
| Synonym | Source |
|---|---|
| Cp-506 | ChEMBL |
| Citations |
|---|