EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N8O2 |
| Net Charge | 0 |
| Average Mass | 532.693 |
| Monoisotopic Mass | 532.32742 |
| SMILES | Cc1cc(N2CCc3c(c(C)nn3CC34CCC(NC(=O)[C@@H]5COCCN5)(CC3)CC4)C2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C29H40N8O2/c1-19-14-25(21-15-31-35(3)26(21)32-19)36-12-4-24-22(16-36)20(2)34-37(24)18-28-5-8-29(9-6-28,10-7-28)33-27(38)23-17-39-13-11-30-23/h14-15,23,30H,4-13,16-18H2,1-3H3,(H,33,38)/t23-,28?,29?/m0/s1 |
| InChIKey | OXDQXRVWDYGAHX-SAVAPUMLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mhv-370 (CHEBI:759834) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Mhv-370 | ChEMBL |
| Mhv370 | ChEMBL |
| Citations |
|---|