EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N3O4 |
| Net Charge | 0 |
| Average Mass | 409.486 |
| Monoisotopic Mass | 409.20016 |
| SMILES | CC(C)OC(=O)[C@@H](Cc1ncccn1)OC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C23H27N3O4/c1-14(2)29-22(27)19(13-20-24-10-5-11-25-20)30-23(28)26-21-17-8-3-6-15(17)12-16-7-4-9-18(16)21/h5,10-12,14,19H,3-4,6-9,13H2,1-2H3,(H,26,28)/t19-/m1/s1 |
| InChIKey | UMUQEMHROZVOTF-LJQANCHMSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nt-0796 (CHEBI:759829) has role cardiovascular drug (CHEBI:35554) |
| nt-0796 (CHEBI:759829) is a indanes (CHEBI:46940) |
| Synonym | Source |
|---|---|
| Nt-0796 | ChEMBL |
| Citations |
|---|