EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H31N5O4 |
| Net Charge | 0 |
| Average Mass | 573.653 |
| Monoisotopic Mass | 573.23760 |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccc4nc(C(=O)N5C[C@H]6C[C@@]67C5=CC(=O)c5ncc(C)c57)cc4c3)oc2c1 |
| InChI | InChI=1S/C34H31N5O4/c1-4-38(5-2)23-8-6-19-12-28(43-27(19)13-23)32(41)36-22-7-9-24-20(10-22)11-25(37-24)33(42)39-17-21-15-34(21)29(39)14-26(40)31-30(34)18(3)16-35-31/h6-14,16,21,35,37H,4-5,15,17H2,1-3H3,(H,36,41)/t21-,34+/m1/s1 |
| InChIKey | XHPVXGJAGWHKNR-IFXFPORBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| u-76074 (CHEBI:759808) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| U-76074 | ChEMBL |