EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28F2O5 |
| Net Charge | 0 |
| Average Mass | 410.457 |
| Monoisotopic Mass | 410.19048 |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(F)(F)COc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C22H28F2O5/c23-22(24,15-29-16-8-4-3-5-9-16)13-12-18-17(19(25)14-20(18)26)10-6-1-2-7-11-21(27)28/h1,3-6,8-9,12-13,17-20,25-26H,2,7,10-11,14-15H2,(H,27,28)/b6-1-,13-12+/t17-,18-,19+,20-/m1/s1 |
| InChIKey | KIQXRQVVYTYYAZ-VKVYFNERSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tafluprost acid (CHEBI:759807) is a carbocyclic fatty acid (CHEBI:35744) |
| Synonyms | Source |
|---|---|
| AFP-172 | ChEMBL |
| Tafluprost acid | ChEMBL |
| Tafluprost free acid | ChEMBL |