EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O |
| Net Charge | 0 |
| Average Mass | 150.181 |
| Monoisotopic Mass | 150.07931 |
| SMILES | CCc1cc(C(N)=O)ccn1 |
| InChI | InChI=1S/C8H10N2O/c1-2-7-5-6(8(9)11)3-4-10-7/h3-5H,2H2,1H3,(H2,9,11) |
| InChIKey | LWTBJUQFUISATQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylisonicotinamide (CHEBI:759805) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-ethylisonicotinamide (CHEBI:759805) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonym | Source |
|---|---|
| 2-ethylisonicotinamide | ChEMBL |