EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C22H17ClN6O |
| Net Charge | 0 |
| Average Mass | 434.887 |
| Monoisotopic Mass | 434.12580 |
| SMILES | C[C@H](Nc1ncnc2ncnc12)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1.O |
| InChI | InChI=1S/C22H17ClN6O.H2O/c1-13(28-21-19-20(25-11-24-19)26-12-27-21)17-10-14-6-5-9-16(23)18(14)22(30)29(17)15-7-3-2-4-8-15;/h2-13H,1H3,(H2,24,25,26,27,28);1H2/t13-;/m0./s1 |
| InChIKey | FQLHRUBTGKTKPZ-ZOWNYOTGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| duvelisib monohydrate (CHEBI:759803) has role antineoplastic agent (CHEBI:35610) |
| duvelisib monohydrate (CHEBI:759803) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| Duvelisib (as hydrate) | ChEMBL |
| Duvelisib hydrate | ChEMBL |
| Duvelisib monohydrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Copiktra | ChEMBL |