EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C28H30N6OS |
| Net Charge | 0 |
| Average Mass | 594.763 |
| Monoisotopic Mass | 594.20830 |
| SMILES | CS(=O)(=O)O.Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C28H30N6OS.CH4O3S/c1-20-5-10-24(16-25(20)31-28-32-26(19-36-28)23-4-3-11-29-17-23)30-27(35)22-8-6-21(7-9-22)18-34-14-12-33(2)13-15-34;1-5(2,3)4/h3-11,16-17,19H,12-15,18H2,1-2H3,(H,30,35)(H,31,32);1H3,(H,2,3,4) |
| InChIKey | TXCWBWKVIZGWEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| masitinib mesylate (CHEBI:759743) has role antiviral agent (CHEBI:22587) |
| masitinib mesylate (CHEBI:759743) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Masitinib methanesulfonate | ChEMBL |
| Masiviera | ChEMBL |
| Brand Name | Source |
|---|---|
| Masivet | ChEMBL |