EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3.C22H25ClO7 |
| Net Charge | 0 |
| Average Mass | 566.003 |
| Monoisotopic Mass | 565.17147 |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1.O=C1CC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C22H25ClO7.C5H7NO3/c1-2-28-16-6-3-13(4-7-16)9-14-10-15(5-8-17(14)23)22-20(27)18(25)19(26)21(11-24,30-22)12-29-22;7-4-2-1-3(6-4)5(8)9/h3-8,10,18-20,24-27H,2,9,11-12H2,1H3;3H,1-2H2,(H,6,7)(H,8,9)/t18-,19-,20+,21-,22-;3-/m00/s1 |
| InChIKey | YHIUPZFKHZTLSH-LXYIGGQGSA-N |
| Roles Classification |
|---|
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ertugliflozin pidolate (CHEBI:759740) has role hypoglycemic agent (CHEBI:35526) |
| ertugliflozin pidolate (CHEBI:759740) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Ertugliflozin l-pyroglutamic acid | ChEMBL |
| Ertugliflozin pidolate | ChEMBL |
| Brand Names | Source |
|---|---|
| Ertugliflozin pidolate component of segluromet | ChEMBL |
| Ertugliflozin pidolate component of steglujan | ChEMBL |
| Steglatro | ChEMBL |