EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C20H21N5O6 |
| Net Charge | 0 |
| Average Mass | 445.432 |
| Monoisotopic Mass | 445.15975 |
| SMILES | Nc1nc(=O)c2c(CCc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2n1.O |
| InChI | InChI=1S/C20H21N5O6.H2O/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27;/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29);1H2/t13-;/m0./s1 |
| InChIKey | NBNBOZLBWLNZHB-ZOWNYOTGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemetrexed monohydrate (CHEBI:759739) has role antineoplastic agent (CHEBI:35610) |
| pemetrexed monohydrate (CHEBI:759739) is a glutamic acid derivative (CHEBI:24315) |
| Synonyms | Source |
|---|---|
| Armisarte | ChEMBL |
| Pemetrexed monohydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Armisarte (previously pemetrexed actavis) | ChEMBL |
| Pemetrexed fresenius kabi | ChEMBL |