EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24Cl2FN5O2 |
| Net Charge | 0 |
| Average Mass | 492.382 |
| Monoisotopic Mass | 491.12911 |
| SMILES | CC(=O)Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1O[C@H](C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H24Cl2FN5O2/c1-13(21-18(24)3-4-19(26)22(21)25)33-20-9-15(10-28-23(20)30-14(2)32)16-11-29-31(12-16)17-5-7-27-8-6-17/h3-4,9-13,17,27H,5-8H2,1-2H3,(H,28,30,32)/t13-/m1/s1 |
| InChIKey | HBWSXXBJOQKNBL-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| unecritinib (CHEBI:759658) has role antineoplastic agent (CHEBI:35610) |
| unecritinib (CHEBI:759658) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| unecritinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tq-b3101 | ChEMBL |
| TQB3101 | ChEMBL |