EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO5S |
| Net Charge | 0 |
| Average Mass | 403.500 |
| Monoisotopic Mass | 403.14534 |
| SMILES | OCCOCCOCCOCCOc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c23-9-10-24-11-12-25-13-14-26-15-16-27-18-7-5-17(6-8-18)21-22-19-3-1-2-4-20(19)28-21/h1-8,23H,9-16H2 |
| InChIKey | XSAIPEACQNRHOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spg-302 (CHEBI:759657) has role antipsychotic agent (CHEBI:35476) |
| spg-302 (CHEBI:759657) is a benzothiazoles (CHEBI:37947) |
| Synonyms | Source |
|---|---|
| Spg-302 | ChEMBL |
| Spg302 | ChEMBL |