EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H49NO2 |
| Net Charge | 0 |
| Average Mass | 503.771 |
| Monoisotopic Mass | 503.37633 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OC(=O)CCCCCCCCC)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(c3cccnc3)=CC[C@@]21[H] |
| InChI | InChI=1S/C34H49NO2/c1-4-5-6-7-8-9-10-13-32(36)37-27-18-20-33(2)26(23-27)14-15-28-30-17-16-29(25-12-11-22-35-24-25)34(30,3)21-19-31(28)33/h11-12,14,16,22,24,27-28,30-31H,4-10,13,15,17-21,23H2,1-3H3/t27-,28-,30-,31-,33-,34+/m0/s1 |
| InChIKey | XPCSGTPPHYORKJ-YHXMLEJGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abiraterone decanoate (CHEBI:759655) has role antineoplastic agent (CHEBI:35610) |
| abiraterone decanoate (CHEBI:759655) is a steroid ester (CHEBI:47880) |
| Synonyms | Source |
|---|---|
| Abiraterone decanoate | ChEMBL |
| Prl-02 | ChEMBL |