EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O4 |
| Net Charge | 0 |
| Average Mass | 222.200 |
| Monoisotopic Mass | 222.06406 |
| SMILES | [O-][n+]1c(CO)c(CO)[n+]([O-])c2ccccc21 |
| InChI | InChI=1S/C10H10N2O4/c13-5-9-10(6-14)12(16)8-4-2-1-3-7(8)11(9)15/h1-4,13-14H,5-6H2 |
| InChIKey | DOIGHQCAQBRSKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dioxydine (CHEBI:759651) has role antiinfective agent (CHEBI:35441) |
| dioxydine (CHEBI:759651) is a quinoxaline derivative (CHEBI:38771) |
| Synonyms | Source |
|---|---|
| Chinoxalindimethanol dioxide | ChEMBL |
| Dioxidin | ChEMBL |
| Dioxidine | ChEMBL |
| Dioxydine | ChEMBL |
| Hydroxymethylquinoxalindioxyde | ChEMBL |
| Metrosept | ChEMBL |