EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N6O3 |
| Net Charge | 0 |
| Average Mass | 492.624 |
| Monoisotopic Mass | 492.28489 |
| SMILES | CN1CCN(C(=O)N(CCCCCCC(=O)NO)c2ccc(-c3ccc4cnn(C)c4c3)cc2)CC1 |
| InChI | InChI=1S/C27H36N6O3/c1-30-15-17-32(18-16-30)27(35)33(14-6-4-3-5-7-26(34)29-36)24-12-10-21(11-13-24)22-8-9-23-20-28-31(2)25(23)19-22/h8-13,19-20,36H,3-7,14-18H2,1-2H3,(H,29,34) |
| InChIKey | YEQGPOVCXMZUBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alteminostat (CHEBI:759645) has role antineoplastic agent (CHEBI:35610) |
| alteminostat (CHEBI:759645) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| Alteminostat | ChEMBL |
| Ckd-581 | ChEMBL |
| CKD581 | ChEMBL |