EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N6O3 |
| Net Charge | 0 |
| Average Mass | 486.576 |
| Monoisotopic Mass | 486.23794 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC)cc1OCCN(C)C |
| InChI | InChI=1S/C27H30N6O3/c1-6-26(34)29-22-15-21(24(35-5)16-25(22)36-14-13-32(2)3)31-27-28-12-11-20(30-27)19-17-33(4)23-10-8-7-9-18(19)23/h6-12,15-17H,1,13-14H2,2-5H3,(H,29,34)(H,28,30,31) |
| InChIKey | BPMZUKYFIDPLEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rezivertinib (CHEBI:759643) has role antineoplastic agent (CHEBI:35610) |
| rezivertinib (CHEBI:759643) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Bpi-7711 | ChEMBL |
| BPI7711 | ChEMBL |
| Rezivertinib | ChEMBL |