EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H59N7O7S |
| Net Charge | 0 |
| Average Mass | 890.120 |
| Monoisotopic Mass | 889.41967 |
| SMILES | CC(C)c1ccccc1[C@@H]1CCCN1C1CC2(CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(NC[C@H]5CC[C@](C)(O)CC5)c([N+](=O)[O-])c4)c(Oc4cnc5nccc5c4)c3)CC2)C1 |
| InChI | InChI=1S/C49H59N7O7S/c1-32(2)39-7-4-5-8-40(39)43-9-6-22-55(43)36-28-49(29-36)19-23-54(24-20-49)35-10-12-41(45(26-35)63-37-25-34-16-21-50-46(34)52-31-37)47(57)53-64(61,62)38-11-13-42(44(27-38)56(59)60)51-30-33-14-17-48(3,58)18-15-33/h4-5,7-8,10-13,16,21,25-27,31-33,36,43,51,58H,6,9,14-15,17-20,22-24,28-30H2,1-3H3,(H,50,52)(H,53,57)/t33-,43-,48-/m0/s1 |
| InChIKey | ZQTKOYMWCCSKON-XKXNWSITSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sonrotoclax (CHEBI:759642) has role antineoplastic agent (CHEBI:35610) |
| sonrotoclax (CHEBI:759642) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| sonrotoclax | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bgb 11417 | ChEMBL |
| BGB-11417 | ChEMBL |
| BGB11417 | ChEMBL |
| Citations |
|---|