EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25FN2O2 |
| Net Charge | 0 |
| Average Mass | 308.397 |
| Monoisotopic Mass | 308.19001 |
| SMILES | Cc1cc(C(=O)N(C)[C@H](CN2CC(O)C2)C(C)C)ccc1F |
| InChI | InChI=1S/C17H25FN2O2/c1-11(2)16(10-20-8-14(21)9-20)19(4)17(22)13-5-6-15(18)12(3)7-13/h5-7,11,14,16,21H,8-10H2,1-4H3/t16-/m1/s1 |
| InChIKey | GAHPWXLXWUVMIV-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-2927 (CHEBI:759641) has role anti-arrhythmia drug (CHEBI:38070) |
| azd-2927 (CHEBI:759641) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Azd 2927 | ChEMBL |
| Azd-2927 | ChEMBL |
| Azd2927 | ChEMBL |
| Ccr2 antagonist 3 | ChEMBL |