EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N4O4 |
| Net Charge | 0 |
| Average Mass | 380.404 |
| Monoisotopic Mass | 380.14846 |
| SMILES | Cc1ccc(Oc2ncc(N3C(=O)NC(C)(C)C3=O)cn2)c2c1OCC21CC1 |
| InChI | InChI=1S/C20H20N4O4/c1-11-4-5-13(14-15(11)27-10-20(14)6-7-20)28-17-21-8-12(9-22-17)24-16(25)19(2,3)23-18(24)26/h4-5,8-9H,6-7,10H2,1-3H3,(H,23,26) |
| InChIKey | JYHHQTRVJFMEGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aut-00206 (CHEBI:759639) has role antipsychotic agent (CHEBI:35476) |
| aut-00206 (CHEBI:759639) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Aut-00206 | ChEMBL |
| Aut00206 | ChEMBL |