EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N3O5 |
| Net Charge | 0 |
| Average Mass | 327.381 |
| Monoisotopic Mass | 327.17942 |
| SMILES | C[C@@H](O)[C@@H](C(N)=O)N1C[C@@]2(CCCN2C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H25N3O5/c1-9(19)10(11(16)20)17-8-15(12(17)21)6-5-7-18(15)13(22)23-14(2,3)4/h9-10,19H,5-8H2,1-4H3,(H2,16,20)/t9-,10+,15+/m1/s1 |
| InChIKey | ABAPCYNTEPGBNJ-FTGAXOIBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zelquistinel (CHEBI:759635) has role antidepressant (CHEBI:35469) |
| zelquistinel (CHEBI:759635) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Agn-241751 | ChEMBL |
| AGN241751 | ChEMBL |
| Gate-251 | ChEMBL |
| GATE251 | ChEMBL |
| Zelquistinel | ChEMBL |