EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14NO4 |
| Net Charge | 0 |
| Average Mass | 206.204 |
| Monoisotopic Mass | 206.09322 |
| SMILES | N[C@@H](C[C@H](CCC[18F])C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14FNO4/c9-3-1-2-5(7(11)12)4-6(10)8(13)14/h5-6H,1-4,10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1/i9-1 |
| InChIKey | MKDNDKMECWBLOF-XUCPOOORSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florilglutamic acid f-18 (CHEBI:759632) has role antineoplastic agent (CHEBI:35610) |
| florilglutamic acid f-18 (CHEBI:759632) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| florilglutamic acid (18f) | WHO MedNet |
| Synonyms | Source |
|---|---|
| 18f-fspg | ChEMBL |
| BAY 94-9392 | ChEMBL |
| BAY-94-9392 | ChEMBL |
| BAY-949392 | ChEMBL |
| (f18) florilglutamic acid | ChEMBL |
| Florilglutamic acid (18-f) | ChEMBL |