EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:759631 - alovudine f-18
| Formula | C10H13N2O4 |
| Net Charge | 0 |
| Average Mass | 243.225 |
| Monoisotopic Mass | 243.08847 |
| SMILES | Cc1cn([C@H]2C[C@H]([18F])[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1/i11-1 |
| InChIKey | UXCAQJAQSWSNPQ-ZIVQXEJRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alovudine f-18 (CHEBI:759631) has role antineoplastic agent (CHEBI:35610) |
| alovudine f-18 (CHEBI:759631) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| Synonyms | Source |
|---|---|
| (18f) flt | ChEMBL |
| (18f)-flt | ChEMBL |
| (18f)flt | ChEMBL |
| 18f-flt | ChEMBL |
| (18f)fludeoxythymidine | ChEMBL |
| 3'-deoxy-3'-(18f)fluorothymidine | ChEMBL |
| Citations |
|---|