EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O4 |
| Net Charge | 0 |
| Average Mass | 284.238 |
| Monoisotopic Mass | 284.08987 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3[18F])c2n1 |
| InChI | InChI=1S/C10H12FN5O4/c11-4-6(18)3(1-17)20-9(4)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1H2,(H3,12,14,15,19)/t3-,4+,6-,9-/m1/s1/i11-1 |
| InChIKey | UXUZARPLRQRNNX-YXAALHNKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| f-arag f-18 (CHEBI:759630) has role antineoplastic agent (CHEBI:35610) |
| f-arag f-18 (CHEBI:759630) is a purine 2'-deoxyribonucleoside (CHEBI:19254) |
| Synonyms | Source |
|---|---|
| 18f-arag | ChEMBL |
| (18f)f-arag | ChEMBL |
| F-arag f-18 | ChEMBL |