EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12F2N8O |
| Net Charge | 0 |
| Average Mass | 370.323 |
| Monoisotopic Mass | 370.11021 |
| SMILES | Cn1cncc1-c1c(F)cncc1NC(=O)c1c(N)nn2cc(F)cnc12 |
| InChI | InChI=1S/C16H12F2N8O/c1-25-7-21-5-11(25)12-9(18)3-20-4-10(12)23-16(27)13-14(19)24-26-6-8(17)2-22-15(13)26/h2-7H,1H3,(H2,19,24)(H,23,27) |
| InChIKey | RBQPCTBFIPVIJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuvusertib (CHEBI:759625) has role antineoplastic agent (CHEBI:35610) |
| tuvusertib (CHEBI:759625) is a pyrazolopyrimidine (CHEBI:38669) |
| INN | Source |
|---|---|
| tuvusertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| M 1774 | ChEMBL |
| M-1774 | ChEMBL |
| M1774 | ChEMBL |