EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N6O3S2 |
| Net Charge | 0 |
| Average Mass | 502.666 |
| Monoisotopic Mass | 502.18208 |
| SMILES | COc1ccc(-c2nc([C@@H](C)Sc3nc(N)cc(N)n3)c(C)s2)cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C23H30N6O3S2/c1-14-21(15(2)34-23-26-19(24)13-20(25)27-23)28-22(33-14)16-4-5-17(30-3)18(12-16)32-11-8-29-6-9-31-10-7-29/h4-5,12-13,15H,6-11H2,1-3H3,(H4,24,25,26,27)/t15-/m1/s1 |
| InChIKey | MFVINMPRHHUSBW-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tre-515 (CHEBI:759624) has role antineoplastic agent (CHEBI:35610) |
| tre-515 (CHEBI:759624) is a thiazoles (CHEBI:48901) |
| Synonym | Source |
|---|---|
| Tre-515 | ChEMBL |