EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H33ClN2O2 |
| Net Charge | 0 |
| Average Mass | 537.103 |
| Monoisotopic Mass | 536.22306 |
| SMILES | COc1ncc(-c2ccc(Cl)cc2)cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C34H33ClN2O2/c1-37(2)21-20-34(38,31-15-9-13-25-10-7-8-14-29(25)31)32(26-11-5-4-6-12-26)30-22-27(23-36-33(30)39-3)24-16-18-28(35)19-17-24/h4-19,22-23,32,38H,20-21H2,1-3H3/t32-,34-/m1/s1 |
| InChIKey | MMUCHWPQRGEHDV-ZFEZZJPFSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sudapyridine (CHEBI:759623) has role antitubercular agent (CHEBI:33231) |
| sudapyridine (CHEBI:759623) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| Sudapyridine | ChEMBL |
| Wx-081 | ChEMBL |