EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.H2O.H4B5O10.Na.H2O.H2O.H2O |
| Net Charge | 0 |
| Average Mass | 331.147 |
| Monoisotopic Mass | 332.06957 |
| SMILES | O.O.O.O.O.OB1OB(O)O[B-]2(O1)OB(O)OB(O)O2.[Na+] |
| InChI | InChI=1S/B5H4O10.Na.5H2O/c6-1-10-2(7)13-5(12-1)14-3(8)11-4(9)15-5;;;;;;/h6-9H;;5*1H2/q-1;+1;;;;; |
| InChIKey | OFWMUVAXPPRZPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium pentaborate pentahydrate (CHEBI:759622) has role anti-obesity agent (CHEBI:74518) |
| sodium pentaborate pentahydrate (CHEBI:759622) has role vulnerary (CHEBI:73336) |
| sodium pentaborate pentahydrate (CHEBI:759622) is a oxoanion (CHEBI:35406) |
| Synonym | Source |
|---|---|
| Sodium pentaborate pentahydrate | ChEMBL |