EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10ClF3N4O |
| Net Charge | 0 |
| Average Mass | 330.697 |
| Monoisotopic Mass | 330.04952 |
| SMILES | O=C1C[C@H](c2cc(F)c(F)c(F)c2)CN1Cn1ncnc1Cl |
| InChI | InChI=1S/C13H10ClF3N4O/c14-13-18-5-19-21(13)6-20-4-8(3-11(20)22)7-1-9(15)12(17)10(16)2-7/h1-2,5,8H,3-4,6H2/t8-/m0/s1 |
| InChIKey | GPGBFZCJDZALPN-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plosaracetam (CHEBI:759621) has role antidepressant (CHEBI:35469) |
| plosaracetam (CHEBI:759621) is a pyrrolidines (CHEBI:38260) |
| INN | Source |
|---|---|
| plosaracetam | WHO MedNet |
| Synonyms | Source |
|---|---|
| Sdi-118 | ChEMBL |
| SDI118 | ChEMBL |