EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N6OS |
| Net Charge | 0 |
| Average Mass | 382.493 |
| Monoisotopic Mass | 382.15758 |
| SMILES | Cc1ccc([C@H]2C[C@@H]2COc2cc(NCc3nnc(C)s3)nc(C)n2)nc1 |
| InChI | InChI=1S/C19H22N6OS/c1-11-4-5-16(20-8-11)15-6-14(15)10-26-18-7-17(22-12(2)23-18)21-9-19-25-24-13(3)27-19/h4-5,7-8,14-15H,6,9-10H2,1-3H3,(H,21,22,23)/t14-,15+/m1/s1 |
| InChIKey | WQKPZDLZRFTMTI-CABCVRRESA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-8189 (CHEBI:759616) has role antipsychotic agent (CHEBI:35476) |
| mk-8189 (CHEBI:759616) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| Mk-8189 | ChEMBL |
| MK8189 | ChEMBL |
| Citations |
|---|