EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H43FN6O3 |
| Net Charge | 0 |
| Average Mass | 590.744 |
| Monoisotopic Mass | 590.33807 |
| SMILES | [H][C@]12CC[C@]([H])(C(=C)C1)[C@@H](C(=O)N1CCC3(CC1)CN(c1ncncc1Oc1ccc(F)cc1C(=O)N(C(C)C)C(C)C)C3)N2 |
| InChI | InChI=1S/C33H43FN6O3/c1-20(2)40(21(3)4)31(41)26-15-23(34)6-9-27(26)43-28-16-35-19-36-30(28)39-17-33(18-39)10-12-38(13-11-33)32(42)29-25-8-7-24(37-29)14-22(25)5/h6,9,15-16,19-21,24-25,29,37H,5,7-8,10-14,17-18H2,1-4H3/t24-,25+,29-/m0/s1 |
| InChIKey | JQHJEDMMWUIYCE-FVVBACEJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enzomenib (CHEBI:759607) has role antineoplastic agent (CHEBI:35610) |
| enzomenib (CHEBI:759607) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| enzomenib | WHO MedNet |
| Synonym | Source |
|---|---|
| Dsp-5336 | ChEMBL |