EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30ClN3O2 |
| Net Charge | 0 |
| Average Mass | 415.965 |
| Monoisotopic Mass | 415.20265 |
| SMILES | [H][C@@]12OCC3(CCN(CCn4ccnc4)CC3)C[C@@]1([H])C(C)(C)Oc1cc(Cl)ccc12 |
| InChI | InChI=1S/C23H30ClN3O2/c1-22(2)19-14-23(5-8-26(9-6-23)11-12-27-10-7-25-16-27)15-28-21(19)18-4-3-17(24)13-20(18)29-22/h3-4,7,10,13,16,19,21H,5-6,8-9,11-12,14-15H2,1-2H3/t19-,21+/m1/s1 |
| InChIKey | QKAZUVQTHFXMLS-CTNGQTDRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dsp-0390 (CHEBI:759606) has role antineoplastic agent (CHEBI:35610) |
| dsp-0390 (CHEBI:759606) is a 1-benzopyran (CHEBI:38443) |
| Synonym | Source |
|---|---|
| Dsp-0390 | ChEMBL |