EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29N3O5 |
| Net Charge | 0 |
| Average Mass | 475.545 |
| Monoisotopic Mass | 475.21072 |
| SMILES | CC(C)NC(=O)c1ccc2c(c1)[C@]1(CCO2)C[C@H]1C(=O)Nc1cc(C#N)ccc1CCCC(=O)O |
| InChI | InChI=1S/C27H29N3O5/c1-16(2)29-25(33)19-8-9-23-20(13-19)27(10-11-35-23)14-21(27)26(34)30-22-12-17(15-28)6-7-18(22)4-3-5-24(31)32/h6-9,12-13,16,21H,3-5,10-11,14H2,1-2H3,(H,29,33)(H,30,34)(H,31,32)/t21-,27-/m0/s1 |
| InChIKey | QSRLBYGDVFRMPT-IDISGSTGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-986310 (CHEBI:759603) has role antineoplastic agent (CHEBI:35610) |
| bms-986310 (CHEBI:759603) is a 1-benzopyran (CHEBI:38443) |
| Synonyms | Source |
|---|---|
| Bms-986310 | ChEMBL |
| Ono-4578 | ChEMBL |