EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30ClN5O3 |
| Net Charge | 0 |
| Average Mass | 484.000 |
| Monoisotopic Mass | 483.20372 |
| SMILES | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)nn(-c2ccc(CCN3CCOCC3)cc2)c1=O |
| InChI | InChI=1S/C25H30ClN5O3/c1-18(2)27-23(32)17-30-24(20-4-3-5-21(26)16-20)28-31(25(30)33)22-8-6-19(7-9-22)10-11-29-12-14-34-15-13-29/h3-9,16,18H,10-15,17H2,1-2H3,(H,27,32) |
| InChIKey | YCLGGNJZGIFVKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brezivaptan (CHEBI:759602) has role antidepressant (CHEBI:35469) |
| brezivaptan (CHEBI:759602) is a ring assembly (CHEBI:36820) |
| brezivaptan (CHEBI:759602) is a triazoles (CHEBI:35727) |
| INN | Source |
|---|---|
| brezivaptan | WHO MedNet |
| Synonyms | Source |
|---|---|
| Anc-501 | ChEMBL |
| THY-1773 | ChEMBL |
| THY1773 | ChEMBL |
| Ts-121 | ChEMBL |