EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 382.287 |
| Monoisotopic Mass | 381.08985 |
| SMILES | CNC(=O)COc1cc(Cl)c(Cc2ccc(O)c(C(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-11(2)14-6-12(4-5-18(14)23)7-15-16(20)8-13(9-17(15)21)25-10-19(24)22-3/h4-6,8-9,11,23H,7,10H2,1-3H3,(H,22,24) |
| InChIKey | CQELSEDWYWTMDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abx-002 (CHEBI:759601) has role antidepressant (CHEBI:35469) |
| abx-002 (CHEBI:759601) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Abx-002 | ChEMBL |
| ABX002 | ChEMBL |
| MA-JD-21 | ChEMBL |
| MA-JD21 | ChEMBL |