EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15F3N4O2 |
| Net Charge | 0 |
| Average Mass | 400.360 |
| Monoisotopic Mass | 400.11471 |
| SMILES | C[C@H](c1cnc(=O)c2cc(F)c(F)cc12)N(C)C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C20H15F3N4O2/c1-10(15-9-25-19(28)14-7-18(23)17(22)6-13(14)15)27(2)20(29)26-12-3-4-16(21)11(5-12)8-24/h3-7,9-10H,1-2H3,(H,25,28)(H,26,29)/t10-/m1/s1 |
| InChIKey | WKCMLORRPISTPL-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ab-836 (CHEBI:759599) has role antiviral agent (CHEBI:22587) |
| ab-836 (CHEBI:759599) is a isoquinolines (CHEBI:24922) |
| Synonym | Source |
|---|---|
| Ab-836 | ChEMBL |