EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O4 |
| Net Charge | 0 |
| Average Mass | 476.742 |
| Monoisotopic Mass | 476.38656 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@](C)(O)CCC=C(C)C)CC[C@@]3(C)[C@]1(C)C[C@H](O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H52O4/c1-18(2)10-9-13-30(8,34)19-11-15-28(6)24(19)20(31)16-22-27(5)14-12-23(33)26(3,4)25(27)21(32)17-29(22,28)7/h10,19-25,31-34H,9,11-17H2,1-8H3/t19-,20+,21-,22+,23-,24-,25-,27+,28+,29+,30-/m0/s1 |
| InChIKey | SHCBCKBYTHZQGZ-CJPZEJHVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protopanaxatriol (CHEBI:75951) has parent hydride dammarane (CHEBI:36488) |
| protopanaxatriol (CHEBI:75951) has role metabolite (CHEBI:25212) |
| protopanaxatriol (CHEBI:75951) is a 12β-hydroxy steroid (CHEBI:36847) |
| protopanaxatriol (CHEBI:75951) is a 3β-hydroxy steroid (CHEBI:36836) |
| protopanaxatriol (CHEBI:75951) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| protopanaxatriol (CHEBI:75951) is a 6α-hydroxy steroid (CHEBI:36850) |
| protopanaxatriol (CHEBI:75951) is a sapogenin (CHEBI:26606) |
| protopanaxatriol (CHEBI:75951) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,6α,12β)-dammar-24-ene-3,6,12,20-tetrol |
| Synonym | Source |
|---|---|
| dammar-24-ene-3β,6α,12β,20-tetrol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (20S)-protopanaxatriol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15447 | MetaCyc |
| Protopanaxatriol | Wikipedia |
| US2011034403 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5771276 | Reaxys |
| CAS:34080-08-5 | ChemIDplus |
| Citations |
|---|