EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N10O13P2 |
| Net Charge | 0 |
| Average Mass | 674.417 |
| Monoisotopic Mass | 674.09995 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@@H]4COP(=O)(O)O[C@H]5[C@@H](O)[C@H](n6cnc7c(N)ncnc76)O[C@@H]5COP(=O)(O)O[C@@H]3[C@@H]4O)c2n1 |
| InChI | InChI=1S/C20H24N10O13P2/c21-14-8-15(24-3-23-14)29(4-25-8)18-11(32)12-7(41-18)2-39-45(36,37)43-13-10(31)6(1-38-44(34,35)42-12)40-19(13)30-5-26-9-16(30)27-20(22)28-17(9)33/h3-7,10-13,18-19,31-32H,1-2H2,(H,34,35)(H,36,37)(H2,21,23,24)(H3,22,27,28,33)/t6-,7-,10-,11-,12-,13-,18-,19-/m1/s1 |
| InChIKey | XRILCFTWUCUKJR-INFSMZHSSA-N |
| Wikipedia |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-3'-cGAMP (CHEBI:75947) has functional parent Gp[2'-5']Ap[3'] (CHEBI:143097) |
| 2'-3'-cGAMP (CHEBI:75947) is a adenyl ribonucleotide (CHEBI:61296) |
| 2'-3'-cGAMP (CHEBI:75947) is a cyclic purine dinucleotide (CHEBI:47037) |
| 2'-3'-cGAMP (CHEBI:75947) is a guanyl ribonucleotide (CHEBI:61295) |
| 2'-3'-cGAMP (CHEBI:75947) is conjugate acid of 2'-3'-cGAMP(2−) (CHEBI:143093) |
| Incoming Relation(s) |
| 2'-3'-cGAMP(2−) (CHEBI:143093) is conjugate base of 2'-3'-cGAMP (CHEBI:75947) |
| IUPAC Name |
|---|
| 2-amino-9-[(5R,7R,8R,12aR,14R,15R,15aS,16R)-14-(6-amino-9H-purin-9-yl)-2,10,15,16-tetrahydroxy-2,10-dioxidooctahydro-12H-5,8-methanofuro[3,2-l][1,3,6,9,11,2,10]pentaoxadiphosphacyclotetradecin-7-yl]-1,9-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 2'-3'-cyclic GMP-AMP | SUBMITTER |
| c[G(2',5')pA(3',5')p] | ChEBI |
| cyclic (guanosine-(2'→5')-monophosphate-adenosine-(3'→5')-monophosphate) | ChEBI |
| 2',5'-3',5'-cGAMP | ChEBI |
| cyclic guanosine monophosphate-adenosine monophosphate | ChEBI |
| 2'-O,5'-O-[(adenosine-3'-O,5'-O-diyl)bisphosphinico]guanosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-15224 | MetaCyc |
| Cyclic_guanosine_monophosphate-adenosine_monophosphate | Wikipedia |
| 1SY | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1441190-66-4 | ChemIDplus |
| Citations |
|---|